Einecs 259-926-0
p-phenylenediamine hydrochloride
CAS: 55972-71-9
Molecular Formula: C6H9ClN2
Einecs 259-926-0 - Names and Identifiers
| Name | p-phenylenediamine hydrochloride |
| Synonyms | Einecs 259-926-0 p-Phenylenediamine HCl 1,4-Phenylenediamine HCL 4-Aminoaniline hydrochloride p-Phenylenediamine hydrochloride p-phenylenediamine hydrochloride 1,4-Diaminobenzene hydrochloride para-phenylene diamine hydrochloride |
| CAS | 55972-71-9 |
| EINECS | 259-926-0 |
| InChI | InChI=1/C6H8N2.ClH/c7-5-1-2-6(8)4-3-5;/h1-4H,7-8H2;1H |
Einecs 259-926-0 - Physico-chemical Properties
| Molecular Formula | C6H9ClN2 |
| Molar Mass | 144.6 |
| Boling Point | 267.4°C at 760 mmHg |
| Flash Point | 135.9°C |
| Vapor Presure | 0.00817mmHg at 25°C |
Einecs 259-926-0 - Introduction
p-phenylenediamine hydrochloride is a white crystalline solid with the formula C6H8N2. HCl. Its properties are as follows:
1. Solubility: p-phenylenediamine hydrochloride can be dissolved in water to produce acidic solution.
2. thermal stability: it can exist stably under high temperature conditions.
3. combustion: p-phenylenediamine hydrochloride can burn when heated or ignited.
p-phenylenediamine hydrochloride has many uses in practical applications:
1. Dyes: p-phenylenediamine hydrochloride can be used as synthetic intermediates for dyes and pigments.
2. cosmetics: it is used as hair dye and eyebrow dye in some cosmetics.
3. medical field: p-phenylenediamine hydrochloride can be used to prepare certain drugs, such as antithrombotic drugs.
There are many ways to prepare p-phenylenediamine hydrochloride:
1. direct reaction method: the reaction of p-phenylenediamine with hydrochloric acid to generate p-phenylenediamine hydrochloride.
2. intermediate method: first prepare the intermediate of p-phenylenediamine, and then react with hydrochloric acid to generate p-phenylenediamine hydrochloride.
Use precautions and safety information for p-phenylenediamine hydrochloride are as follows:
1. use should wear protective gloves, safety glasses and protective clothing.
2. avoid inhalation or contact with the skin, if necessary, use a protective mask.
3. use to maintain a well-ventilated environment.
4. Store in a dry, cool, ventilated place, away from fire and oxidant.
5. if accidentally inhaled or ingested, seek medical advice immediately.
1. Solubility: p-phenylenediamine hydrochloride can be dissolved in water to produce acidic solution.
2. thermal stability: it can exist stably under high temperature conditions.
3. combustion: p-phenylenediamine hydrochloride can burn when heated or ignited.
p-phenylenediamine hydrochloride has many uses in practical applications:
1. Dyes: p-phenylenediamine hydrochloride can be used as synthetic intermediates for dyes and pigments.
2. cosmetics: it is used as hair dye and eyebrow dye in some cosmetics.
3. medical field: p-phenylenediamine hydrochloride can be used to prepare certain drugs, such as antithrombotic drugs.
There are many ways to prepare p-phenylenediamine hydrochloride:
1. direct reaction method: the reaction of p-phenylenediamine with hydrochloric acid to generate p-phenylenediamine hydrochloride.
2. intermediate method: first prepare the intermediate of p-phenylenediamine, and then react with hydrochloric acid to generate p-phenylenediamine hydrochloride.
Use precautions and safety information for p-phenylenediamine hydrochloride are as follows:
1. use should wear protective gloves, safety glasses and protective clothing.
2. avoid inhalation or contact with the skin, if necessary, use a protective mask.
3. use to maintain a well-ventilated environment.
4. Store in a dry, cool, ventilated place, away from fire and oxidant.
5. if accidentally inhaled or ingested, seek medical advice immediately.
Last Update：2024-04-09 21:21:28
Supplier List
View History